C13H18OS — CID 10987858
trans-(1R,2R)-2-benzylsulfanylcyclohexan-1-ol (PubChem CID 10987858) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is trans-(1R,2R)-2-benzylsulfanylcyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-benzylsulfanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10987858 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | trans-(1R,2R)-2-benzylsulfanylcyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1SCc1ccccc1 |
| InChI | InChI=1S/C13H18OS/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-14H,4-5,8-10H2/t12-,13-/m1/s1 |
| InChIKey | KFEUHCXDITWBNA-CHWSQXEVSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |