About 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate
3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate (PubChem CID 10987922) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate |
| PubChem CID | 10987922 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC=C(C(=O)OC)[C@@H]1C |
| InChI | InChI=1S/C11H15NO4/c1-4-7-16-11(14)12-6-5-9(8(12)2)10(13)15-3/h4-5,8H,1,6-7H2,2-3H3/t8-/m0/s1 |
| InChIKey | PKPCXXNPCJSBHR-QMMMGPOBSA-N |
| XLogP | 1.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate?
The IUPAC name of 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate (CID 10987922) is 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate.
What is the SMILES notation for 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate?
The canonical SMILES for 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate is C=CCOC(=O)N1CC=C(C(=O)OC)[C@@H]1C.
What is the InChIKey of 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate?
The InChIKey is PKPCXXNPCJSBHR-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H15NO4/c1-4-7-16-11(14)12-6-5-9(8(12)2)10(13)15-3/h4-5,8H,1,6-7H2,2-3H3/t8-/m0/s1.
What are the key properties of 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate?
3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate has a molecular weight of 225.24 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-2,5-dihydropyrrole-1,3-dicarboxylate is sourced from PubChem (CID 10987922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).