C12H26O2Si — CID 10988078
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanal (PubChem CID 10988078) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanal.
| Compound Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanal |
|---|---|
| PubChem CID | 10988078 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanal |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C12H26O2Si/c1-8-11(10(2)9-13)14-15(6,7)12(3,4)5/h9-11H,8H2,1-7H3/t10?,11-/m1/s1 |
| InChIKey | SXHWKIAHBBABIA-RRKGBCIJSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|