About ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate
ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate (PubChem CID 10988222) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate |
| PubChem CID | 10988222 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](c2ccccc2)ON1C |
| InChI | InChI=1S/C13H17NO3/c1-3-16-13(15)11-9-12(17-14(11)2)10-7-5-4-6-8-10/h4-8,11-12H,3,9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | HXJKHHRAZAXNOG-VXGBXAGGSA-N |
| XLogP | 1.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate?
The IUPAC name of ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate (CID 10988222) is ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate.
What is the SMILES notation for ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate?
The canonical SMILES for ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate is CCOC(=O)[C@H]1C[C@H](c2ccccc2)ON1C.
What is the InChIKey of ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate?
The InChIKey is HXJKHHRAZAXNOG-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H17NO3/c1-3-16-13(15)11-9-12(17-14(11)2)10-7-5-4-6-8-10/h4-8,11-12H,3,9H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate?
ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate has a molecular weight of 235.28 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R,5R)-2-methyl-5-phenyl-1,2-oxazolidine-3-carboxylate is sourced from PubChem (CID 10988222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).