C12H14O5 — CID 10988315
methyl (3aR,8bS)-8-oxo-2,3a,5,6,7,8b-hexahydro-1H-furo[2,3-b][1]benzofuran-6-carboxylate (PubChem CID 10988315) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is methyl (3aR,8bS)-8-oxo-2,3a,5,6,7,8b-hexahydro-1H-furo[2,3-b][1]benzofuran-6-carboxylate.
| Compound Name | methyl (3aR,8bS)-8-oxo-2,3a,5,6,7,8b-hexahydro-1H-furo[2,3-b][1]benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 10988315 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl (3aR,8bS)-8-oxo-2,3a,5,6,7,8b-hexahydro-1H-furo[2,3-b][1]benzofuran-6-carboxylate |
| SMILES | COC(=O)C1CC(=O)C2=C(C1)O[C@H]1OCC[C@@H]21 |
| InChI | InChI=1S/C12H14O5/c1-15-11(14)6-4-8(13)10-7-2-3-16-12(7)17-9(10)5-6/h6-7,12H,2-5H2,1H3/t6?,7-,12+/m0/s1 |
| InChIKey | DBGBCTLSWWJJRN-ZSEDYMPZSA-N |
| XLogP | 0.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |