C14H24O3 — CID 10988401
(5E)-7-tert-butylperoxy-2,6-dimethylocta-2,5-dien-4-one (PubChem CID 10988401) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (5E)-7-tert-butylperoxy-2,6-dimethylocta-2,5-dien-4-one.
| Compound Name | (5E)-7-tert-butylperoxy-2,6-dimethylocta-2,5-dien-4-one |
|---|---|
| PubChem CID | 10988401 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (5E)-7-tert-butylperoxy-2,6-dimethylocta-2,5-dien-4-one |
| SMILES | CC(C)=CC(=O)/C=C(\C)C(C)OOC(C)(C)C |
| InChI | InChI=1S/C14H24O3/c1-10(2)8-13(15)9-11(3)12(4)16-17-14(5,6)7/h8-9,12H,1-7H3/b11-9+ |
| InChIKey | WRKRHOAXSYSXLU-PKNBQFBNSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|