C12H18O5 — CID 10988448
(1R,2R,6R,8S)-4,4-diethyl-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one (PubChem CID 10988448) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1R,2R,6R,8S)-4,4-diethyl-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one.
| Compound Name | (1R,2R,6R,8S)-4,4-diethyl-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one |
|---|---|
| PubChem CID | 10988448 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1R,2R,6R,8S)-4,4-diethyl-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one |
| SMILES | CCC1(CC)O[C@H]2[C@H]3C[C@@](O)(C[C@H]2O1)C(=O)O3 |
| InChI | InChI=1S/C12H18O5/c1-3-12(4-2)16-8-6-11(14)5-7(9(8)17-12)15-10(11)13/h7-9,14H,3-6H2,1-2H3/t7-,8-,9+,11-/m1/s1 |
| InChIKey | BLBATLZXHPGXQK-SDNRWEOFSA-N |
| XLogP | 0.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |