About 2-(benzylamino)ethyl propanoate
2-(benzylamino)ethyl propanoate (PubChem CID 10988499) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(benzylamino)ethyl propanoate.
Molecular Properties
| Compound Name | 2-(benzylamino)ethyl propanoate |
| PubChem CID | 10988499 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(benzylamino)ethyl propanoate |
| SMILES | CCC(=O)OCCNCc1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c1-2-12(14)15-9-8-13-10-11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
| InChIKey | PNNGGRFORHPSHM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzylamino)ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)ethyl propanoate?
The IUPAC name of 2-(benzylamino)ethyl propanoate (CID 10988499) is 2-(benzylamino)ethyl propanoate.
What is the SMILES notation for 2-(benzylamino)ethyl propanoate?
The canonical SMILES for 2-(benzylamino)ethyl propanoate is CCC(=O)OCCNCc1ccccc1.
What is the InChIKey of 2-(benzylamino)ethyl propanoate?
The InChIKey is PNNGGRFORHPSHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-2-12(14)15-9-8-13-10-11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3.
What are the key properties of 2-(benzylamino)ethyl propanoate?
2-(benzylamino)ethyl propanoate has a molecular weight of 207.27 g/mol, XLogP of 1.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)ethyl propanoate is sourced from PubChem (CID 10988499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).