C15H16O3 — CID 10988516
(3aS,9aR,9bR)-6,9a-dimethyl-3-methylidene-3a,4,5,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione (PubChem CID 10988516) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3aS,9aR,9bR)-6,9a-dimethyl-3-methylidene-3a,4,5,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione.
| Compound Name | (3aS,9aR,9bR)-6,9a-dimethyl-3-methylidene-3a,4,5,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 10988516 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3aS,9aR,9bR)-6,9a-dimethyl-3-methylidene-3a,4,5,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1CCC(C)=C1C=CC(=O)[C@]12C |
| InChI | InChI=1S/C15H16O3/c1-8-4-5-10-9(2)14(17)18-13(10)15(3)11(8)6-7-12(15)16/h6-7,10,13H,2,4-5H2,1,3H3/t10-,13+,15-/m0/s1 |
| InChIKey | XSWAZIGOOCZRGU-ZBINZKHDSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|