About methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate
methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate (PubChem CID 10988648) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate.
Molecular Properties
| Compound Name | methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate |
| PubChem CID | 10988648 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/C1=CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H24O2/c1-16(2,3)14-11-9-13(10-12-14)7-5-6-8-15(17)18-4/h5-9,14H,10-12H2,1-4H3/b7-5+,8-6+ |
| InChIKey | KINBTKAQHPYMQX-KQQUZDAGSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate?
The IUPAC name of methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate (CID 10988648) is methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate.
What is the SMILES notation for methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate?
The canonical SMILES for methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate is COC(=O)/C=C/C=C/C1=CCC(C(C)(C)C)CC1.
What is the InChIKey of methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate?
The InChIKey is KINBTKAQHPYMQX-KQQUZDAGSA-N. The full InChI is InChI=1S/C16H24O2/c1-16(2,3)14-11-9-13(10-12-14)7-5-6-8-15(17)18-4/h5-9,14H,10-12H2,1-4H3/b7-5+,8-6+.
What are the key properties of methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate?
methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate has a molecular weight of 248.37 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E,4E)-5-(4-tert-butylcyclohexen-1-yl)penta-2,4-dienoate is sourced from PubChem (CID 10988648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).