C7H9IO2 — CID 10988749
(3aS,6R,6aR)-6-iodo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 10988749) has the molecular formula C7H9IO2 and a molecular weight of 252.05 g/mol. Its IUPAC name is (3aS,6R,6aR)-6-iodo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,6R,6aR)-6-iodo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10988749 |
| Molecular Formula | C7H9IO2 |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | (3aS,6R,6aR)-6-iodo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2CC[C@@H](I)[C@@H]2O1 |
| InChI | InChI=1S/C7H9IO2/c8-5-2-1-4-3-6(9)10-7(4)5/h4-5,7H,1-3H2/t4-,5+,7+/m0/s1 |
| InChIKey | CMPQBFWDBHKWRY-HBPOCXIASA-N |
| XLogP | 1.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|