C21H21NO5 — CID 1098878
dimethyl (2S)-2-(2-hydroxynaphthalen-1-yl)-4,6-dimethyl-1,2-dihydropyridine-3,5-dicarboxylate (PubChem CID 1098878) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is dimethyl (2S)-2-(2-hydroxynaphthalen-1-yl)-4,6-dimethyl-1,2-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl (2S)-2-(2-hydroxynaphthalen-1-yl)-4,6-dimethyl-1,2-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 1098878 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | dimethyl (2S)-2-(2-hydroxynaphthalen-1-yl)-4,6-dimethyl-1,2-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N[C@@H](c2c(O)ccc3ccccc23)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C21H21NO5/c1-11-16(20(24)26-3)12(2)22-19(17(11)21(25)27-4)18-14-8-6-5-7-13(14)9-10-15(18)23/h5-10,19,22-23H,1-4H3/t19-/m1/s1 |
| InChIKey | CEQKYXRUKRQKBZ-LJQANCHMSA-N |
| XLogP | 3.13 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|