N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride

C9H6Cl2F3N — CID 10988866

IUPACN-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride
SMILESFC(F)(F)/C(Cl)=N/Cc1ccc(Cl)cc1
InChIInChI=1S/C9H6Cl2F3N/c10-7-3-1-6(2-4-7)5-15-8(11)9(12,13)14/h1-4H,5H2/b15-8-
InChIKeyWUIRKDMXJRSDPX-NVNXTCNLSA-N
MW256.05 g/mol
LogP4.04
Rot. Bonds2

About N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride

N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride (PubChem CID 10988866) has the molecular formula C9H6Cl2F3N and a molecular weight of 256.05 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride.

Molecular Properties

Compound NameN-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride
PubChem CID10988866
Molecular FormulaC9H6Cl2F3N
Molecular Weight256.05 g/mol
Exact Mass254.98
IUPAC NameN-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride
SMILESFC(F)(F)/C(Cl)=N/Cc1ccc(Cl)cc1
InChIInChI=1S/C9H6Cl2F3N/c10-7-3-1-6(2-4-7)5-15-8(11)9(12,13)14/h1-4H,5H2/b15-8-
InChIKeyWUIRKDMXJRSDPX-NVNXTCNLSA-N
XLogP4.04
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.05
LogP ≤ 54.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride?
The IUPAC name of N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride (CID 10988866) is N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride.
What is the SMILES notation for N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride?
The canonical SMILES for N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride is FC(F)(F)/C(Cl)=N/Cc1ccc(Cl)cc1.
What is the InChIKey of N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride?
The InChIKey is WUIRKDMXJRSDPX-NVNXTCNLSA-N. The full InChI is InChI=1S/C9H6Cl2F3N/c10-7-3-1-6(2-4-7)5-15-8(11)9(12,13)14/h1-4H,5H2/b15-8-.
What are the key properties of N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride?
N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride has a molecular weight of 256.05 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chlorophenyl)methyl]-2,2,2-trifluoroethanimidoyl chloride is sourced from PubChem (CID 10988866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).