C13H16F2OS — CID 10988962
1-(1,1-difluorohex-1-en-2-yl)-2-methylsulfinylbenzene (PubChem CID 10988962) has the molecular formula C13H16F2OS and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-(1,1-difluorohex-1-en-2-yl)-2-methylsulfinylbenzene.
| Compound Name | 1-(1,1-difluorohex-1-en-2-yl)-2-methylsulfinylbenzene |
|---|---|
| PubChem CID | 10988962 |
| Molecular Formula | C13H16F2OS |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-(1,1-difluorohex-1-en-2-yl)-2-methylsulfinylbenzene |
| SMILES | CCCCC(=C(F)F)c1ccccc1S(C)=O |
| InChI | InChI=1S/C13H16F2OS/c1-3-4-7-11(13(14)15)10-8-5-6-9-12(10)17(2)16/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | NKTFASARGQHYLX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |