C12H20O4S — CID 10989032
(3aS,4R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole (PubChem CID 10989032) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 10989032 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (3aS,4R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@@H]2[C@@H]([C@H]3COC(C)(C)O3)SC[C@@H]2O1 |
| InChI | InChI=1S/C12H20O4S/c1-11(2)13-5-7(14-11)10-9-8(6-17-10)15-12(3,4)16-9/h7-10H,5-6H2,1-4H3/t7-,8+,9+,10-/m1/s1 |
| InChIKey | QDMSJAPLEVJBRD-XFWSIPNHSA-N |
| XLogP | 1.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |