About [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate
[4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate (PubChem CID 1098906) has the molecular formula C20H12N2O6
and a molecular weight of 376.32 g/mol. Its IUPAC name is [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate.
Molecular Properties
| Compound Name | [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate |
| PubChem CID | 1098906 |
| Molecular Formula | C20H12N2O6 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)c3cccc4c([N+](=O)[O-])ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C20H12N2O6/c1-11(23)28-13-7-5-12(6-8-13)21-19(24)15-4-2-3-14-17(22(26)27)10-9-16(18(14)15)20(21)25/h2-10H,1H3 |
| InChIKey | VBSBLNFVVXXVQZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate?
The IUPAC name of [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate (CID 1098906) is [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate.
What is the SMILES notation for [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate?
The canonical SMILES for [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate is CC(=O)Oc1ccc(N2C(=O)c3cccc4c([N+](=O)[O-])ccc(c34)C2=O)cc1.
What is the InChIKey of [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate?
The InChIKey is VBSBLNFVVXXVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O6/c1-11(23)28-13-7-5-12(6-8-13)21-19(24)15-4-2-3-14-17(22(26)27)10-9-16(18(14)15)20(21)25/h2-10H,1H3.
What are the key properties of [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate?
[4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate has a molecular weight of 376.32 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] acetate is sourced from PubChem (CID 1098906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).