C15H22O4 — CID 10989198
methyl (3'aS,7'aR)-6'-ethylspiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-4'-carboxylate (PubChem CID 10989198) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (3'aS,7'aR)-6'-ethylspiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-4'-carboxylate.
| Compound Name | methyl (3'aS,7'aR)-6'-ethylspiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-4'-carboxylate |
|---|---|
| PubChem CID | 10989198 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl (3'aS,7'aR)-6'-ethylspiro[1,3-dioxolane-2,1'-2,3,3a,4,7,7a-hexahydroindene]-4'-carboxylate |
| SMILES | CCC1=CC(C(=O)OC)[C@H]2CCC3(OCCO3)[C@@H]2C1 |
| InChI | InChI=1S/C15H22O4/c1-3-10-8-12(14(16)17-2)11-4-5-15(13(11)9-10)18-6-7-19-15/h8,11-13H,3-7,9H2,1-2H3/t11-,12?,13-/m1/s1 |
| InChIKey | WOIILWKKCMCWPE-LKOMHFJYSA-N |
| XLogP | 2.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|