C14H22N2O3 — CID 10989203
methyl (2R)-2-[[(1S)-1-amino-3-ethenylcyclopent-3-ene-1-carbonyl]amino]-3-methylbutanoate (PubChem CID 10989203) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (2R)-2-[[(1S)-1-amino-3-ethenylcyclopent-3-ene-1-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[[(1S)-1-amino-3-ethenylcyclopent-3-ene-1-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 10989203 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | methyl (2R)-2-[[(1S)-1-amino-3-ethenylcyclopent-3-ene-1-carbonyl]amino]-3-methylbutanoate |
| SMILES | C=CC1=CC[C@@](N)(C(=O)N[C@@H](C(=O)OC)C(C)C)C1 |
| InChI | InChI=1S/C14H22N2O3/c1-5-10-6-7-14(15,8-10)13(18)16-11(9(2)3)12(17)19-4/h5-6,9,11H,1,7-8,15H2,2-4H3,(H,16,18)/t11-,14+/m1/s1 |
| InChIKey | RGIXOQRRJMMFLD-RISCZKNCSA-N |
| XLogP | 0.90 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |