C15H25NO3 — CID 10989245
(3R,8aR)-3-(hydroxymethyl)-7,7-dimethyl-8a-(2-methylpropyl)-1,2,3,6-tetrahydroindolizine-5,8-dione (PubChem CID 10989245) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (3R,8aR)-3-(hydroxymethyl)-7,7-dimethyl-8a-(2-methylpropyl)-1,2,3,6-tetrahydroindolizine-5,8-dione.
| Compound Name | (3R,8aR)-3-(hydroxymethyl)-7,7-dimethyl-8a-(2-methylpropyl)-1,2,3,6-tetrahydroindolizine-5,8-dione |
|---|---|
| PubChem CID | 10989245 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (3R,8aR)-3-(hydroxymethyl)-7,7-dimethyl-8a-(2-methylpropyl)-1,2,3,6-tetrahydroindolizine-5,8-dione |
| SMILES | CC(C)C[C@@]12CC[C@H](CO)N1C(=O)CC(C)(C)C2=O |
| InChI | InChI=1S/C15H25NO3/c1-10(2)7-15-6-5-11(9-17)16(15)12(18)8-14(3,4)13(15)19/h10-11,17H,5-9H2,1-4H3/t11-,15-/m1/s1 |
| InChIKey | QANONKNAFXACDW-IAQYHMDHSA-N |
| XLogP | 1.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |