C14H20O5 — CID 10989266
(6S)-3,6-dihydroxy-5-methoxy-4,6-dimethyl-2-(2-methylbutanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 10989266) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (6S)-3,6-dihydroxy-5-methoxy-4,6-dimethyl-2-(2-methylbutanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | (6S)-3,6-dihydroxy-5-methoxy-4,6-dimethyl-2-(2-methylbutanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 10989266 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (6S)-3,6-dihydroxy-5-methoxy-4,6-dimethyl-2-(2-methylbutanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CCC(C)C(=O)C1=C(O)C(C)=C(OC)[C@](C)(O)C1=O |
| InChI | InChI=1S/C14H20O5/c1-6-7(2)10(15)9-11(16)8(3)13(19-5)14(4,18)12(9)17/h7,16,18H,6H2,1-5H3/t7?,14-/m1/s1 |
| InChIKey | GWJXOYLJHYLPOG-GGEPSNLQSA-N |
| XLogP | 1.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|