C15H24O4 — CID 10989275
(2R)-2-[(1R,4R,4aS,8S,8aS)-8-hydroperoxy-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalen-1-yl]propanoic acid (PubChem CID 10989275) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (2R)-2-[(1R,4R,4aS,8S,8aS)-8-hydroperoxy-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalen-1-yl]propanoic acid.
| Compound Name | (2R)-2-[(1R,4R,4aS,8S,8aS)-8-hydroperoxy-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 10989275 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (2R)-2-[(1R,4R,4aS,8S,8aS)-8-hydroperoxy-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalen-1-yl]propanoic acid |
| SMILES | C=C1CC[C@@H]2[C@@H]([C@H]([C@@H](C)C(=O)O)CC[C@H]2C)[C@@H]1OO |
| InChI | InChI=1S/C15H24O4/c1-8-4-7-12(10(3)15(16)17)13-11(8)6-5-9(2)14(13)19-18/h8,10-14,18H,2,4-7H2,1,3H3,(H,16,17)/t8-,10-,11+,12+,13+,14-/m1/s1 |
| InChIKey | PLAYIZSYWHFSJD-VUASIYQVSA-N |
| XLogP | 3.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|