C16H35N3 — CID 10989314
1,1,2,3,3-penta(propan-2-yl)guanidine (PubChem CID 10989314) has the molecular formula C16H35N3 and a molecular weight of 269.48 g/mol. Its IUPAC name is 1,1,2,3,3-penta(propan-2-yl)guanidine.
| Compound Name | 1,1,2,3,3-penta(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 10989314 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | 1,1,2,3,3-penta(propan-2-yl)guanidine |
| SMILES | CC(C)N=C(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H35N3/c1-11(2)17-16(18(12(3)4)13(5)6)19(14(7)8)15(9)10/h11-15H,1-10H3 |
| InChIKey | YKRBTEJVESWMGV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|