About [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate
[1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate (PubChem CID 10989342) has the molecular formula C13H22O4Si
and a molecular weight of 270.40 g/mol. Its IUPAC name is [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate.
Molecular Properties
| Compound Name | [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate |
| PubChem CID | 10989342 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate |
| SMILES | CC(=O)OC(C#C[Si](C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H22O4Si/c1-10(14)16-11(7-8-18(4,5)6)12-9-15-13(2,3)17-12/h11-12H,9H2,1-6H3/t11?,12-/m1/s1 |
| InChIKey | ZWJOEZLRAYMDQH-PIJUOVFKSA-N |
| XLogP | 1.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate?
The IUPAC name of [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate (CID 10989342) is [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate.
What is the SMILES notation for [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate?
The canonical SMILES for [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate is CC(=O)OC(C#C[Si](C)(C)C)[C@H]1COC(C)(C)O1.
What is the InChIKey of [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate?
The InChIKey is ZWJOEZLRAYMDQH-PIJUOVFKSA-N. The full InChI is InChI=1S/C13H22O4Si/c1-10(14)16-11(7-8-18(4,5)6)12-9-15-13(2,3)17-12/h11-12H,9H2,1-6H3/t11?,12-/m1/s1.
What are the key properties of [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate?
[1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate has a molecular weight of 270.40 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl] acetate is sourced from PubChem (CID 10989342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).