About 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one
1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one (PubChem CID 10989453) has the molecular formula C17H22O3
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one.
Molecular Properties
| Compound Name | 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one |
| PubChem CID | 10989453 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one |
| SMILES | O=C(C#CC1(O)CCCCC1)C#CC1(O)CCCCC1 |
| InChI | InChI=1S/C17H22O3/c18-15(7-13-16(19)9-3-1-4-10-16)8-14-17(20)11-5-2-6-12-17/h19-20H,1-6,9-12H2 |
| InChIKey | BNRJIRDSVTVKAX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one?
The IUPAC name of 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one (CID 10989453) is 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one.
What is the SMILES notation for 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one?
The canonical SMILES for 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one is O=C(C#CC1(O)CCCCC1)C#CC1(O)CCCCC1.
What is the InChIKey of 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one?
The InChIKey is BNRJIRDSVTVKAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O3/c18-15(7-13-16(19)9-3-1-4-10-16)8-14-17(20)11-5-2-6-12-17/h19-20H,1-6,9-12H2.
What are the key properties of 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one?
1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one has a molecular weight of 274.36 g/mol, XLogP of 1.95, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(1-hydroxycyclohexyl)penta-1,4-diyn-3-one is sourced from PubChem (CID 10989453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).