C15H18O5 — CID 10989541
dimethyl (2S,3aS,4R)-2,4-bis(ethenyl)-2,3,4,5-tetrahydrocyclopenta[b]furan-3a,6-dicarboxylate (PubChem CID 10989541) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is dimethyl (2S,3aS,4R)-2,4-bis(ethenyl)-2,3,4,5-tetrahydrocyclopenta[b]furan-3a,6-dicarboxylate.
| Compound Name | dimethyl (2S,3aS,4R)-2,4-bis(ethenyl)-2,3,4,5-tetrahydrocyclopenta[b]furan-3a,6-dicarboxylate |
|---|---|
| PubChem CID | 10989541 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | dimethyl (2S,3aS,4R)-2,4-bis(ethenyl)-2,3,4,5-tetrahydrocyclopenta[b]furan-3a,6-dicarboxylate |
| SMILES | C=C[C@@H]1C[C@@]2(C(=O)OC)C(=C(C(=O)OC)C[C@@H]2C=C)O1 |
| InChI | InChI=1S/C15H18O5/c1-5-9-7-11(13(16)18-3)12-15(9,14(17)19-4)8-10(6-2)20-12/h5-6,9-10H,1-2,7-8H2,3-4H3/t9-,10+,15-/m0/s1 |
| InChIKey | PLIIDFUXMMLTOU-WMFXKJRFSA-N |
| XLogP | 1.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|