C17H28O3 — CID 10989631
[(4aS,5S,8S,8aR)-5-hydroxy-5-methyl-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalen-2-yl]methyl acetate (PubChem CID 10989631) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(4aS,5S,8S,8aR)-5-hydroxy-5-methyl-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalen-2-yl]methyl acetate.
| Compound Name | [(4aS,5S,8S,8aR)-5-hydroxy-5-methyl-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10989631 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(4aS,5S,8S,8aR)-5-hydroxy-5-methyl-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalen-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H]2[C@H](C(C)C)CC[C@](C)(O)[C@H]2CC1 |
| InChI | InChI=1S/C17H28O3/c1-11(2)14-7-8-17(4,19)16-6-5-13(9-15(14)16)10-20-12(3)18/h9,11,14-16,19H,5-8,10H2,1-4H3/t14-,15-,16-,17-/m0/s1 |
| InChIKey | XLTDPRQIEUARTG-QAETUUGQSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|