About 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline
5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline (PubChem CID 10989668) has the molecular formula C11H8BrNO3
and a molecular weight of 282.09 g/mol. Its IUPAC name is 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline.
Molecular Properties
| Compound Name | 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline |
| PubChem CID | 10989668 |
| Molecular Formula | C11H8BrNO3 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline |
| SMILES | COc1c2c(c3cnccc3c1Br)OCO2 |
| InChI | InChI=1S/C11H8BrNO3/c1-14-10-8(12)6-2-3-13-4-7(6)9-11(10)16-5-15-9/h2-4H,5H2,1H3 |
| InChIKey | PEEGBXPNGFPEDL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline?
The IUPAC name of 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline (CID 10989668) is 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline.
What is the SMILES notation for 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline?
The canonical SMILES for 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline is COc1c2c(c3cnccc3c1Br)OCO2.
What is the InChIKey of 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline?
The InChIKey is PEEGBXPNGFPEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO3/c1-14-10-8(12)6-2-3-13-4-7(6)9-11(10)16-5-15-9/h2-4H,5H2,1H3.
What are the key properties of 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline?
5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline has a molecular weight of 282.09 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-methoxy-[1,3]dioxolo[4,5-h]isoquinoline is sourced from PubChem (CID 10989668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).