C15H11NO5 — CID 10989757
2,5-dihydroxy-3-(7-methoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 10989757) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2,5-dihydroxy-3-(7-methoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3-(7-methoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10989757 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2,5-dihydroxy-3-(7-methoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1cccc2c(C3=C(O)C(=O)C=C(O)C3=O)c[nH]c12 |
| InChI | InChI=1S/C15H11NO5/c1-21-11-4-2-3-7-8(6-16-13(7)11)12-14(19)9(17)5-10(18)15(12)20/h2-6,16-17,20H,1H3 |
| InChIKey | UVVUMRGSDMFUHO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|