C16H18O5 — CID 10989900
[3-[(2E,4E)-hexa-2,4-dienoyl]-4-hydroxy-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl] acetate (PubChem CID 10989900) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is [3-[(2E,4E)-hexa-2,4-dienoyl]-4-hydroxy-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl] acetate.
| Compound Name | [3-[(2E,4E)-hexa-2,4-dienoyl]-4-hydroxy-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 10989900 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [3-[(2E,4E)-hexa-2,4-dienoyl]-4-hydroxy-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl] acetate |
| SMILES | C/C=C/C=C/C(=O)C1=CC(C)(OC(C)=O)C(=O)C(C)=C1O |
| InChI | InChI=1S/C16H18O5/c1-5-6-7-8-13(18)12-9-16(4,21-11(3)17)15(20)10(2)14(12)19/h5-9,19H,1-4H3/b6-5+,8-7+ |
| InChIKey | KAHQLTNFJHOWOD-BSWSSELBSA-N |
| XLogP | 2.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|