C19H34O2 — CID 10990078
(4R,5S)-4-ethenyl-5-tridecyloxolan-2-one (PubChem CID 10990078) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (4R,5S)-4-ethenyl-5-tridecyloxolan-2-one.
| Compound Name | (4R,5S)-4-ethenyl-5-tridecyloxolan-2-one |
|---|---|
| PubChem CID | 10990078 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (4R,5S)-4-ethenyl-5-tridecyloxolan-2-one |
| SMILES | C=C[C@H]1CC(=O)O[C@H]1CCCCCCCCCCCCC |
| InChI | InChI=1S/C19H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-17(4-2)16-19(20)21-18/h4,17-18H,2-3,5-16H2,1H3/t17-,18-/m0/s1 |
| InChIKey | OXKHYJRSFCNTPE-ROUUACIJSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|