About [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate
[(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate (PubChem CID 10990253) has the molecular formula C15H25ClO2Si
and a molecular weight of 300.90 g/mol. Its IUPAC name is [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate.
Molecular Properties
| Compound Name | [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate |
| PubChem CID | 10990253 |
| Molecular Formula | C15H25ClO2Si |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate |
| SMILES | CCCCC[C@H](/C=C/CCl)OC(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H25ClO2Si/c1-5-6-7-9-14(10-8-12-16)18-15(17)11-13-19(2,3)4/h8,10,14H,5-7,9,12H2,1-4H3/b10-8+/t14-/m1/s1 |
| InChIKey | LTSTUSSKXKKKJS-QSYFUGGGSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate?
The IUPAC name of [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate (CID 10990253) is [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate.
What is the SMILES notation for [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate?
The canonical SMILES for [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate is CCCCC[C@H](/C=C/CCl)OC(=O)C#C[Si](C)(C)C.
What is the InChIKey of [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate?
The InChIKey is LTSTUSSKXKKKJS-QSYFUGGGSA-N. The full InChI is InChI=1S/C15H25ClO2Si/c1-5-6-7-9-14(10-8-12-16)18-15(17)11-13-19(2,3)4/h8,10,14H,5-7,9,12H2,1-4H3/b10-8+/t14-/m1/s1.
What are the key properties of [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate?
[(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate has a molecular weight of 300.90 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,4R)-1-chloronon-2-en-4-yl] 3-trimethylsilylprop-2-ynoate is sourced from PubChem (CID 10990253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).