C18H24O2S — CID 10990362
(1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-(2-methylpropylidene)-8-oxabicyclo[5.1.0]octane (PubChem CID 10990362) has the molecular formula C18H24O2S and a molecular weight of 304.45 g/mol. Its IUPAC name is (1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-(2-methylpropylidene)-8-oxabicyclo[5.1.0]octane.
| Compound Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-(2-methylpropylidene)-8-oxabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 10990362 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-(2-methylpropylidene)-8-oxabicyclo[5.1.0]octane |
| SMILES | CC(C)/C=C1\C[C@H](S(=O)c2ccccc2)CC[C@H]2O[C@@]12C |
| InChI | InChI=1S/C18H24O2S/c1-13(2)11-14-12-16(9-10-17-18(14,3)20-17)21(19)15-7-5-4-6-8-15/h4-8,11,13,16-17H,9-10,12H2,1-3H3/b14-11+/t16-,17-,18+,21?/m1/s1 |
| InChIKey | GEVYEQHQDQLGTB-WDPSBCLWSA-N |
| XLogP | 4.09 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|