About ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate
ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate (PubChem CID 10990395) has the molecular formula C18H24FNO2
and a molecular weight of 305.39 g/mol. Its IUPAC name is ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate |
| PubChem CID | 10990395 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1([C@H]2CN([C@@H](C)c3ccccc3)C[C@@H]2F)CC1 |
| InChI | InChI=1S/C18H24FNO2/c1-3-22-17(21)18(9-10-18)15-11-20(12-16(15)19)13(2)14-7-5-4-6-8-14/h4-8,13,15-16H,3,9-12H2,1-2H3/t13-,15-,16-/m0/s1 |
| InChIKey | JMGASJSYPNCYSH-BPUTZDHNSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
The IUPAC name of ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate (CID 10990395) is ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate is CCOC(=O)C1([C@H]2CN([C@@H](C)c3ccccc3)C[C@@H]2F)CC1.
What is the InChIKey of ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
The InChIKey is JMGASJSYPNCYSH-BPUTZDHNSA-N. The full InChI is InChI=1S/C18H24FNO2/c1-3-22-17(21)18(9-10-18)15-11-20(12-16(15)19)13(2)14-7-5-4-6-8-14/h4-8,13,15-16H,3,9-12H2,1-2H3/t13-,15-,16-/m0/s1.
What are the key properties of ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate has a molecular weight of 305.39 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(3S,4R)-4-fluoro-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate is sourced from PubChem (CID 10990395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).