C18H16N2O3 — CID 10990481
5,6-dimethoxy-11,15-diazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13(18),14,16-heptaen-12-one (PubChem CID 10990481) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 5,6-dimethoxy-11,15-diazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13(18),14,16-heptaen-12-one.
| Compound Name | 5,6-dimethoxy-11,15-diazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13(18),14,16-heptaen-12-one |
|---|---|
| PubChem CID | 10990481 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 5,6-dimethoxy-11,15-diazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13(18),14,16-heptaen-12-one |
| SMILES | COc1cc2c(cc1OC)CCN1C(=O)c3cnccc3C1=C2 |
| InChI | InChI=1S/C18H16N2O3/c1-22-16-8-11-4-6-20-15(7-12(11)9-17(16)23-2)13-3-5-19-10-14(13)18(20)21/h3,5,7-10H,4,6H2,1-2H3 |
| InChIKey | WPGRWTSFAAMEFM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |