C18H30O4 — CID 10990543
ethyl (3Z)-3,9-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)deca-3,9-dienoate (PubChem CID 10990543) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is ethyl (3Z)-3,9-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)deca-3,9-dienoate.
| Compound Name | ethyl (3Z)-3,9-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)deca-3,9-dienoate |
|---|---|
| PubChem CID | 10990543 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethyl (3Z)-3,9-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)deca-3,9-dienoate |
| SMILES | C=C(C)CCC(C/C=C(/C)CC(=O)OCC)C1(C)OCCO1 |
| InChI | InChI=1S/C18H30O4/c1-6-20-17(19)13-15(4)8-10-16(9-7-14(2)3)18(5)21-11-12-22-18/h8,16H,2,6-7,9-13H2,1,3-5H3/b15-8- |
| InChIKey | ZZVUNHWOCPYUEX-NVNXTCNLSA-N |
| XLogP | 4.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|