C16H26O4Si — CID 10990550
[(2R,3S,6S)-6-propan-2-yloxy-2-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 10990550) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is [(2R,3S,6S)-6-propan-2-yloxy-2-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2R,3S,6S)-6-propan-2-yloxy-2-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 10990550 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [(2R,3S,6S)-6-propan-2-yloxy-2-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](OC(C)C)O[C@@H]1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H26O4Si/c1-12(2)18-16-10-9-15(19-13(3)17)14(20-16)8-7-11-21(4,5)6/h9-10,12,14-16H,8H2,1-6H3/t14-,15+,16+/m1/s1 |
| InChIKey | WMHTZSFUVZJBPJ-PMPSAXMXSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|