C18H20N2O3 — CID 10990601
ethyl 2-(14-methyl-5-oxo-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,6,12,14-pentaen-4-yl)acetate (PubChem CID 10990601) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl 2-(14-methyl-5-oxo-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,6,12,14-pentaen-4-yl)acetate.
| Compound Name | ethyl 2-(14-methyl-5-oxo-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,6,12,14-pentaen-4-yl)acetate |
|---|---|
| PubChem CID | 10990601 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethyl 2-(14-methyl-5-oxo-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,6,12,14-pentaen-4-yl)acetate |
| SMILES | CCOC(=O)Cn1nc2c(cc1=O)CCCc1ccc(C)cc1-2 |
| InChI | InChI=1S/C18H20N2O3/c1-3-23-17(22)11-20-16(21)10-14-6-4-5-13-8-7-12(2)9-15(13)18(14)19-20/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | KREIEVBXIKVEKA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |