About [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol
[3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol (PubChem CID 10990611) has the molecular formula C20H40O2
and a molecular weight of 312.54 g/mol. Its IUPAC name is [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol.
Molecular Properties
| Compound Name | [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol |
| PubChem CID | 10990611 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1(C)OC1CO |
| InChI | InChI=1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5)19(15-21)22-20/h16-19,21H,6-15H2,1-5H3 |
| InChIKey | DSWPRMYGLZQURA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol?
The IUPAC name of [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol (CID 10990611) is [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol.
What is the SMILES notation for [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol?
The canonical SMILES for [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol is CC(C)CCCC(C)CCCC(C)CCCC1(C)OC1CO.
What is the InChIKey of [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol?
The InChIKey is DSWPRMYGLZQURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5)19(15-21)22-20/h16-19,21H,6-15H2,1-5H3.
What are the key properties of [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol?
[3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol has a molecular weight of 312.54 g/mol, XLogP of 5.58, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-3-(4,8,12-trimethyltridecyl)oxiran-2-yl]methanol is sourced from PubChem (CID 10990611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).