C15H28O5Si — CID 10990728
(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-oxopropyl]-3,5-dimethyloxolan-2-one (PubChem CID 10990728) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is (3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-oxopropyl]-3,5-dimethyloxolan-2-one.
| Compound Name | (3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-oxopropyl]-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 10990728 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-oxopropyl]-3,5-dimethyloxolan-2-one |
| SMILES | CC(=O)[C@H](O)[C@]1(C)OC(=O)[C@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O5Si/c1-9-12(20-21(7,8)14(3,4)5)15(6,19-13(9)18)11(17)10(2)16/h9,11-12,17H,1-8H3/t9-,11+,12-,15+/m1/s1 |
| InChIKey | MFIPXEMZTOUMDW-FQMFCJFBSA-N |
| XLogP | 2.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|