About (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal
(3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal (PubChem CID 10990818) has the molecular formula C15H28O7
and a molecular weight of 320.38 g/mol. Its IUPAC name is (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal.
Molecular Properties
| Compound Name | (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal |
| PubChem CID | 10990818 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal |
| SMILES | C=C[C@H](C[C@@H](CC=O)OCOCCOC)OCOCCOC |
| InChI | InChI=1S/C15H28O7/c1-4-14(21-12-19-9-7-17-2)11-15(5-6-16)22-13-20-10-8-18-3/h4,6,14-15H,1,5,7-13H2,2-3H3/t14-,15-/m1/s1 |
| InChIKey | PDTVTKGIICDZED-HUUCEWRRSA-N |
| XLogP | 1.16 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal?
The IUPAC name of (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal (CID 10990818) is (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal.
What is the SMILES notation for (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal?
The canonical SMILES for (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal is C=C[C@H](C[C@@H](CC=O)OCOCCOC)OCOCCOC.
What is the InChIKey of (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal?
The InChIKey is PDTVTKGIICDZED-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H28O7/c1-4-14(21-12-19-9-7-17-2)11-15(5-6-16)22-13-20-10-8-18-3/h4,6,14-15H,1,5,7-13H2,2-3H3/t14-,15-/m1/s1.
What are the key properties of (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal?
(3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal has a molecular weight of 320.38 g/mol, XLogP of 1.16, 17 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3,5-bis(2-methoxyethoxymethoxy)hept-6-enal is sourced from PubChem (CID 10990818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).