C20H35NO2 — CID 10990870
(1R,3S,4R,5R,9S,12R)-8,8,12-trimethyl-4-propan-2-yl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol (PubChem CID 10990870) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is (1R,3S,4R,5R,9S,12R)-8,8,12-trimethyl-4-propan-2-yl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol.
| Compound Name | (1R,3S,4R,5R,9S,12R)-8,8,12-trimethyl-4-propan-2-yl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol |
|---|---|
| PubChem CID | 10990870 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (1R,3S,4R,5R,9S,12R)-8,8,12-trimethyl-4-propan-2-yl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol |
| SMILES | C=C(C)[C@@H]1CN2[C@@H](O[C@@H]3C[C@H](C)CC[C@H]3C2(C)C)[C@@]1(O)C(C)C |
| InChI | InChI=1S/C20H35NO2/c1-12(2)16-11-21-18(20(16,22)13(3)4)23-17-10-14(5)8-9-15(17)19(21,6)7/h13-18,22H,1,8-11H2,2-7H3/t14-,15-,16+,17-,18+,20-/m1/s1 |
| InChIKey | CPVLSYSZJIGTFE-CZLFUSQZSA-N |
| XLogP | 3.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|