About 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole
5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole (PubChem CID 1099092) has the molecular formula C23H16BrN3
and a molecular weight of 414.31 g/mol. Its IUPAC name is 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole.
Molecular Properties
| Compound Name | 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole |
| PubChem CID | 1099092 |
| Molecular Formula | C23H16BrN3 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole |
| SMILES | Brc1ccc2[nH]cc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c2c1 |
| InChI | InChI=1S/C23H16BrN3/c24-17-11-12-20-18(13-17)19(14-25-20)23-26-21(15-7-3-1-4-8-15)22(27-23)16-9-5-2-6-10-16/h1-14,25H,(H,26,27) |
| InChIKey | OLLZOAQYIWWSFA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole?
The IUPAC name of 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole (CID 1099092) is 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole.
What is the SMILES notation for 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole?
The canonical SMILES for 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole is Brc1ccc2[nH]cc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c2c1.
What is the InChIKey of 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole?
The InChIKey is OLLZOAQYIWWSFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16BrN3/c24-17-11-12-20-18(13-17)19(14-25-20)23-26-21(15-7-3-1-4-8-15)22(27-23)16-9-5-2-6-10-16/h1-14,25H,(H,26,27).
What are the key properties of 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole?
5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole has a molecular weight of 414.31 g/mol, XLogP of 6.65, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole is sourced from PubChem (CID 1099092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).