C16H24O7 — CID 10991070
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S,3S)-3-hydroxy-4-phenylbutan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 10991070) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S,3S)-3-hydroxy-4-phenylbutan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S,3S)-3-hydroxy-4-phenylbutan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 10991070 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S,3S)-3-hydroxy-4-phenylbutan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C16H24O7/c1-9(11(18)7-10-5-3-2-4-6-10)22-16-15(21)14(20)13(19)12(8-17)23-16/h2-6,9,11-21H,7-8H2,1H3/t9-,11-,12+,13+,14-,15+,16+/m0/s1 |
| InChIKey | VXCHCEMGVYEDHV-FGOXOWFVSA-N |
| XLogP | -1.21 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |