C19H29NO2Si — CID 10991179
(4S)-3-[(3R,4S)-2-methyl-4-trimethylsilylhex-5-en-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10991179) has the molecular formula C19H29NO2Si and a molecular weight of 331.53 g/mol. Its IUPAC name is (4S)-3-[(3R,4S)-2-methyl-4-trimethylsilylhex-5-en-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R,4S)-2-methyl-4-trimethylsilylhex-5-en-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10991179 |
| Molecular Formula | C19H29NO2Si |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (4S)-3-[(3R,4S)-2-methyl-4-trimethylsilylhex-5-en-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]([C@@H](C(C)C)N1C(=O)OC[C@@H]1c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C19H29NO2Si/c1-7-17(23(4,5)6)18(14(2)3)20-16(13-22-19(20)21)15-11-9-8-10-12-15/h7-12,14,16-18H,1,13H2,2-6H3/t16-,17+,18-/m1/s1 |
| InChIKey | FVYGJXBPZHGGCB-FGTMMUONSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|