C16H28O7 — CID 10991189
(4R,5R,6R)-5,6-bis(2-methoxyethoxymethoxy)oct-7-en-1-yn-4-ol (PubChem CID 10991189) has the molecular formula C16H28O7 and a molecular weight of 332.39 g/mol. Its IUPAC name is (4R,5R,6R)-5,6-bis(2-methoxyethoxymethoxy)oct-7-en-1-yn-4-ol.
| Compound Name | (4R,5R,6R)-5,6-bis(2-methoxyethoxymethoxy)oct-7-en-1-yn-4-ol |
|---|---|
| PubChem CID | 10991189 |
| Molecular Formula | C16H28O7 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (4R,5R,6R)-5,6-bis(2-methoxyethoxymethoxy)oct-7-en-1-yn-4-ol |
| SMILES | C#CC[C@@H](O)[C@@H](OCOCCOC)[C@@H](C=C)OCOCCOC |
| InChI | InChI=1S/C16H28O7/c1-5-7-14(17)16(23-13-21-11-9-19-4)15(6-2)22-12-20-10-8-18-3/h1,6,14-17H,2,7-13H2,3-4H3/t14-,15-,16-/m1/s1 |
| InChIKey | AFNLOGXLMWVQNY-BZUAXINKSA-N |
| XLogP | 0.57 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|