About tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate
tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate (PubChem CID 10991280) has the molecular formula C16H33NO6
and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate |
| PubChem CID | 10991280 |
| Molecular Formula | C16H33NO6 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate |
| SMILES | CC[C@@H](OCOCCOC)[C@H](CCCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H33NO6/c1-6-14(22-12-21-11-10-20-5)13(8-7-9-18)17-15(19)23-16(2,3)4/h13-14,18H,6-12H2,1-5H3,(H,17,19)/t13-,14+/m0/s1 |
| InChIKey | VHRPJKNQNWRBSD-UONOGXRCSA-N |
| XLogP | 2.07 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate?
The IUPAC name of tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate (CID 10991280) is tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate is CC[C@@H](OCOCCOC)[C@H](CCCO)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate?
The InChIKey is VHRPJKNQNWRBSD-UONOGXRCSA-N. The full InChI is InChI=1S/C16H33NO6/c1-6-14(22-12-21-11-10-20-5)13(8-7-9-18)17-15(19)23-16(2,3)4/h13-14,18H,6-12H2,1-5H3,(H,17,19)/t13-,14+/m0/s1.
What are the key properties of tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate?
tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate has a molecular weight of 335.44 g/mol, XLogP of 2.07, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(4S,5R)-1-hydroxy-5-(2-methoxyethoxymethoxy)heptan-4-yl]carbamate is sourced from PubChem (CID 10991280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).