About 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride
7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride (PubChem CID 10991428) has the molecular formula C11H11Cl2NO5S
and a molecular weight of 340.18 g/mol. Its IUPAC name is 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride |
| PubChem CID | 10991428 |
| Molecular Formula | C11H11Cl2NO5S |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride |
| SMILES | NC(=O)C(Cl)Cc1cc2c(cc1S(=O)(=O)Cl)OCCO2 |
| InChI | InChI=1S/C11H11Cl2NO5S/c12-7(11(14)15)3-6-4-8-9(19-2-1-18-8)5-10(6)20(13,16)17/h4-5,7H,1-3H2,(H2,14,15) |
| InChIKey | DJFFLVUVQSJIPK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
The IUPAC name of 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride (CID 10991428) is 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride.
What is the SMILES notation for 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
The canonical SMILES for 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride is NC(=O)C(Cl)Cc1cc2c(cc1S(=O)(=O)Cl)OCCO2.
What is the InChIKey of 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
The InChIKey is DJFFLVUVQSJIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NO5S/c12-7(11(14)15)3-6-4-8-9(19-2-1-18-8)5-10(6)20(13,16)17/h4-5,7H,1-3H2,(H2,14,15).
What are the key properties of 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride has a molecular weight of 340.18 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-amino-2-chloro-3-oxopropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride is sourced from PubChem (CID 10991428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).