C21H27NO3 — CID 10991474
1-phenyl-N-(2,2,2-triethoxy-1-phenylethyl)methanimine (PubChem CID 10991474) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-phenyl-N-(2,2,2-triethoxy-1-phenylethyl)methanimine.
| Compound Name | 1-phenyl-N-(2,2,2-triethoxy-1-phenylethyl)methanimine |
|---|---|
| PubChem CID | 10991474 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-phenyl-N-(2,2,2-triethoxy-1-phenylethyl)methanimine |
| SMILES | CCOC(OCC)(OCC)C(/N=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c1-4-23-21(24-5-2,25-6-3)20(19-15-11-8-12-16-19)22-17-18-13-9-7-10-14-18/h7-17,20H,4-6H2,1-3H3/b22-17+ |
| InChIKey | LOENASPJARPNMT-OQKWZONESA-N |
| XLogP | 4.61 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|