C18H24Cl2O2 — CID 10991513
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2,2-dichloroacetate (PubChem CID 10991513) has the molecular formula C18H24Cl2O2 and a molecular weight of 343.29 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2,2-dichloroacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 10991513 |
| Molecular Formula | C18H24Cl2O2 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2,2-dichloroacetate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)C(Cl)Cl)C1 |
| InChI | InChI=1S/C18H24Cl2O2/c1-12-9-10-14(15(11-12)22-17(21)16(19)20)18(2,3)13-7-5-4-6-8-13/h4-8,12,14-16H,9-11H2,1-3H3/t12-,14-,15-/m1/s1 |
| InChIKey | UVZWXTLSJPYBAU-BPLDGKMQSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|