C20H31N3O2 — CID 10991584
(1S,3aS,5S,7aR)-1-[(E)-2-(dimethylamino)ethoxyiminomethyl]-7a-methyl-5-pyridin-4-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol (PubChem CID 10991584) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (1S,3aS,5S,7aR)-1-[(E)-2-(dimethylamino)ethoxyiminomethyl]-7a-methyl-5-pyridin-4-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol.
| Compound Name | (1S,3aS,5S,7aR)-1-[(E)-2-(dimethylamino)ethoxyiminomethyl]-7a-methyl-5-pyridin-4-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
|---|---|
| PubChem CID | 10991584 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (1S,3aS,5S,7aR)-1-[(E)-2-(dimethylamino)ethoxyiminomethyl]-7a-methyl-5-pyridin-4-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
| SMILES | CN(C)CCO/N=C/[C@H]1CC[C@]2(O)C[C@@H](c3ccncc3)CC[C@]12C |
| InChI | InChI=1S/C20H31N3O2/c1-19-8-4-17(16-6-10-21-11-7-16)14-20(19,24)9-5-18(19)15-22-25-13-12-23(2)3/h6-7,10-11,15,17-18,24H,4-5,8-9,12-14H2,1-3H3/b22-15+/t17-,18+,19+,20-/m0/s1 |
| InChIKey | ZTFAAOXQJBQKAW-BHBZXUJYSA-N |
| XLogP | 3.06 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|